191-24-2 Benzo[ghi]perylene
| Ονομασ?α του προ??ντο? |
Benzo[ghi]perylene |
| Αγγλικ? ?νομα |
Benzo[ghi]perylene; 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
| MF |
C22H12 |
| Μοριακ? β?ρο? |
276.3307 |
| InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
| CAS ΟΧΙ |
191-24-2 |
| EINECS |
205-883-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.378g/cm3 |
| Σημε?ο τ?ξη? |
276-280℃ |
| Σημε?ο βρασμο? |
501°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
2.009 |
| Σημε?ο αν?φλεξη? |
247.2°C |
| Π?εση ατμ?ν |
1.12E-09mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R40:Possible risks of irreversible effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|